C21H11Cl4F9N2O2 — CID 134418376
2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzamide (PubChem CID 134418376) has the molecular formula C21H11Cl4F9N2O2 and a molecular weight of 636.12 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134418376 |
| Molecular Formula | C21H11Cl4F9N2O2 |
| Molecular Weight | 636.12 g/mol |
| Exact Mass | 633.94 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)c1cc(NC(=O)C2C(c3ccc(F)c(Cl)c3)C2(Cl)Cl)cc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C21H11Cl4F9N2O2/c22-11-3-7(1-2-12(11)26)13-14(19(13,24)25)17(38)36-8-4-9(15(23)10(5-8)20(29,30)31)16(37)35-6-18(27,28)21(32,33)34/h1-5,13-14H,6H2,(H,35,37)(H,36,38) |
| InChIKey | UCJFCYFINCRSDW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.12 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|