C20H13Cl3F8N2O2 — CID 163513561
2,2-dichloro-3-(3-chloro-4-fluorophenyl)-N-[3,4-difluoro-5-[hydroxy-(2,2,3,3,3-pentafluoropropylamino)methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 163513561) has the molecular formula C20H13Cl3F8N2O2 and a molecular weight of 571.68 g/mol. Its IUPAC name is 2,2-dichloro-3-(3-chloro-4-fluorophenyl)-N-[3,4-difluoro-5-[hydroxy-(2,2,3,3,3-pentafluoropropylamino)methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-3-(3-chloro-4-fluorophenyl)-N-[3,4-difluoro-5-[hydroxy-(2,2,3,3,3-pentafluoropropylamino)methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163513561 |
| Molecular Formula | C20H13Cl3F8N2O2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 569.99 |
| IUPAC Name | 2,2-dichloro-3-(3-chloro-4-fluorophenyl)-N-[3,4-difluoro-5-[hydroxy-(2,2,3,3,3-pentafluoropropylamino)methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(C(O)NCC(F)(F)C(F)(F)F)c1)C1C(c2ccc(F)c(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C20H13Cl3F8N2O2/c21-10-3-7(1-2-11(10)24)13-14(19(13,22)23)17(35)33-8-4-9(15(26)12(25)5-8)16(34)32-6-18(27,28)20(29,30)31/h1-5,13-14,16,32,34H,6H2,(H,33,35) |
| InChIKey | DETWQNCSEUGPFE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|