C25H12Cl4F7N3O3 — CID 140860376
5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2,3-difluorobenzamide (PubChem CID 140860376) has the molecular formula C25H12Cl4F7N3O3 and a molecular weight of 677.19 g/mol. Its IUPAC name is 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2,3-difluorobenzamide.
| Compound Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 140860376 |
| Molecular Formula | C25H12Cl4F7N3O3 |
| Molecular Weight | 677.19 g/mol |
| Exact Mass | 674.95 |
| IUPAC Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2,3-difluorobenzamide |
| SMILES | O=C(Nc1cc(NC(=O)C(F)(F)F)c(F)cc1F)c1cc(NC(=O)[C@H]2[C@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)cc(F)c1F |
| InChI | InChI=1S/C25H12Cl4F7N3O3/c26-11-2-1-8(3-12(11)27)18-19(24(18,28)29)22(41)37-9-4-10(20(33)15(32)5-9)21(40)38-16-7-17(14(31)6-13(16)30)39-23(42)25(34,35)36/h1-7,18-19H,(H,37,41)(H,38,40)(H,39,42)/t18-,19+/m0/s1 |
| InChIKey | GYFPPTJORNCBNC-RBUKOAKNSA-N |
| XLogP | 7.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.19 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|