C26H14Cl6F5N3O3 — CID 140859450
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-3-methylbenzamide (PubChem CID 140859450) has the molecular formula C26H14Cl6F5N3O3 and a molecular weight of 724.12 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-3-methylbenzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 140859450 |
| Molecular Formula | C26H14Cl6F5N3O3 |
| Molecular Weight | 724.12 g/mol |
| Exact Mass | 720.91 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-3-methylbenzamide |
| SMILES | Cc1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)cc(C(=O)Nc2cc(NC(=O)C(F)(F)F)c(F)cc2F)c1Cl |
| InChI | InChI=1S/C26H14Cl6F5N3O3/c1-8-2-10(38-23(42)19-18(25(19,31)32)9-3-12(27)21(30)13(28)4-9)5-11(20(8)29)22(41)39-16-7-17(15(34)6-14(16)33)40-24(43)26(35,36)37/h2-7,18-19H,1H3,(H,38,42)(H,39,41)(H,40,43)/t18-,19+/m0/s1 |
| InChIKey | MJJJNYDJNQTODG-RBUKOAKNSA-N |
| XLogP | 9.17 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.12 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|