C25H13Cl6F4N3O3 — CID 140859531
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[(2,2-difluoroacetyl)amino]-2,4-difluorophenyl]benzamide (PubChem CID 140859531) has the molecular formula C25H13Cl6F4N3O3 and a molecular weight of 692.11 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[(2,2-difluoroacetyl)amino]-2,4-difluorophenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[(2,2-difluoroacetyl)amino]-2,4-difluorophenyl]benzamide |
|---|---|
| PubChem CID | 140859531 |
| Molecular Formula | C25H13Cl6F4N3O3 |
| Molecular Weight | 692.11 g/mol |
| Exact Mass | 688.90 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[(2,2-difluoroacetyl)amino]-2,4-difluorophenyl]benzamide |
| SMILES | O=C(Nc1cc(NC(=O)C(F)F)c(F)cc1F)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C25H13Cl6F4N3O3/c26-11-2-1-9(36-23(40)19-18(25(19,30)31)8-3-12(27)20(29)13(28)4-8)5-10(11)22(39)37-16-7-17(15(33)6-14(16)32)38-24(41)21(34)35/h1-7,18-19,21H,(H,36,40)(H,37,39)(H,38,41)/t18-,19+/m0/s1 |
| InChIKey | QAKVFTGLGIDFOA-RBUKOAKNSA-N |
| XLogP | 8.56 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.11 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|