C23H12Cl5F3N2O2 — CID 140860195
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide (PubChem CID 140860195) has the molecular formula C23H12Cl5F3N2O2 and a molecular weight of 582.62 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 140860195 |
| Molecular Formula | C23H12Cl5F3N2O2 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 579.93 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-fluorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cc(NC(=O)[C@H]2[C@H](c3cc(F)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H12Cl5F3N2O2/c24-13-3-2-11(8-12(13)21(34)33-17-4-1-10(29)7-15(17)30)32-22(35)19-18(23(19,27)28)9-5-14(25)20(26)16(31)6-9/h1-8,18-19H,(H,32,35)(H,33,34)/t18-,19+/m0/s1 |
| InChIKey | FUZDHDONCJTRGG-RBUKOAKNSA-N |
| XLogP | 7.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|