C25H16Cl4F2N2O2 — CID 122619470
2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide (PubChem CID 122619470) has the molecular formula C25H16Cl4F2N2O2 and a molecular weight of 556.22 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 122619470 |
| Molecular Formula | C25H16Cl4F2N2O2 |
| Molecular Weight | 556.22 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)benzamide |
| SMILES | C=Cc1cc(Cl)cc(C2C(C(=O)Nc3ccc(Cl)c(C(=O)Nc4ccc(F)cc4F)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C25H16Cl4F2N2O2/c1-2-12-7-13(9-14(26)8-12)21-22(25(21,28)29)24(35)32-16-4-5-18(27)17(11-16)23(34)33-20-6-3-15(30)10-19(20)31/h2-11,21-22H,1H2,(H,32,35)(H,33,34) |
| InChIKey | PUHGZXPUKSXMDO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.22 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|