C23H13Cl4F3N2O2 — CID 122618971
5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)-2-fluorobenzamide (PubChem CID 122618971) has the molecular formula C23H13Cl4F3N2O2 and a molecular weight of 548.18 g/mol. Its IUPAC name is 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)-2-fluorobenzamide.
| Compound Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 122618971 |
| Molecular Formula | C23H13Cl4F3N2O2 |
| Molecular Weight | 548.18 g/mol |
| Exact Mass | 545.97 |
| IUPAC Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,4-difluorophenyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1F |
| InChI | InChI=1S/C23H13Cl4F3N2O2/c24-11-5-10(6-12(25)7-11)19-20(23(19,26)27)22(34)31-14-2-3-16(29)15(9-14)21(33)32-18-4-1-13(28)8-17(18)30/h1-9,19-20H,(H,31,34)(H,32,33) |
| InChIKey | ACDAVOLXCZYJNN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.18 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|