C23H13Cl5F2N2O2 — CID 165144557
N-[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2,4-difluorobenzamide (PubChem CID 165144557) has the molecular formula C23H13Cl5F2N2O2 and a molecular weight of 564.63 g/mol. Its IUPAC name is N-[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 165144557 |
| Molecular Formula | C23H13Cl5F2N2O2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 561.94 |
| IUPAC Name | N-[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H13Cl5F2N2O2/c24-11-5-10(6-12(25)7-11)19-20(23(19,27)28)22(34)31-14-2-4-16(26)18(9-14)32-21(33)15-3-1-13(29)8-17(15)30/h1-9,19-20H,(H,31,34)(H,32,33)/t19-,20+/m0/s1 |
| InChIKey | VKYFNEWJVNGROJ-VQTJNVASSA-N |
| XLogP | 7.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|