C24H15Cl6F2N3O2 — CID 134418617
N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-3-methylbenzamide (PubChem CID 134418617) has the molecular formula C24H15Cl6F2N3O2 and a molecular weight of 628.12 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-3-methylbenzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 134418617 |
| Molecular Formula | C24H15Cl6F2N3O2 |
| Molecular Weight | 628.12 g/mol |
| Exact Mass | 624.93 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-3-methylbenzamide |
| SMILES | Cc1cc(NC(=O)C2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)cc(C(=O)Nc2ccc(F)c(N)c2F)c1Cl |
| InChI | InChI=1S/C24H15Cl6F2N3O2/c1-8-4-10(7-11(18(8)27)22(36)35-15-3-2-14(31)21(33)20(15)32)34-23(37)17-16(24(17,29)30)9-5-12(25)19(28)13(26)6-9/h2-7,16-17H,33H2,1H3,(H,34,37)(H,35,36)/t16-,17?/m0/s1 |
| InChIKey | FOIMJIRZXKXJNR-BHWOMJMDSA-N |
| XLogP | 8.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.12 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|