C19H13Cl3F3N3O3 — CID 134417873
N-(5-acetamido-2,3,4-trifluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide (PubChem CID 134417873) has the molecular formula C19H13Cl3F3N3O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-(5-acetamido-2,3,4-trifluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-(5-acetamido-2,3,4-trifluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 134417873 |
| Molecular Formula | C19H13Cl3F3N3O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | N-(5-acetamido-2,3,4-trifluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2cc(NC(=O)C3CC3(Cl)Cl)ccc2Cl)c(F)c(F)c1F |
| InChI | InChI=1S/C19H13Cl3F3N3O3/c1-7(29)26-12-5-13(15(24)16(25)14(12)23)28-17(30)9-4-8(2-3-11(9)20)27-18(31)10-6-19(10,21)22/h2-5,10H,6H2,1H3,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | YOHOJCYLBZISPA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|