C18H15Cl3FN3O3 — CID 138653570
2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-[3-fluoro-5-(methoxyamino)phenyl]benzamide (PubChem CID 138653570) has the molecular formula C18H15Cl3FN3O3 and a molecular weight of 446.69 g/mol. Its IUPAC name is 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-[3-fluoro-5-(methoxyamino)phenyl]benzamide.
| Compound Name | 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-[3-fluoro-5-(methoxyamino)phenyl]benzamide |
|---|---|
| PubChem CID | 138653570 |
| Molecular Formula | C18H15Cl3FN3O3 |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-[3-fluoro-5-(methoxyamino)phenyl]benzamide |
| SMILES | CONc1cc(F)cc(NC(=O)c2cc(NC(=O)C3CC3(Cl)Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C18H15Cl3FN3O3/c1-28-25-12-5-9(22)4-11(6-12)24-16(26)13-7-10(2-3-15(13)19)23-17(27)14-8-18(14,20)21/h2-7,14,25H,8H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | PGULSNKRUGGEQX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|