C16H10Cl3F2N3O2 — CID 167224847
N-[2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]-5,6-difluoropyridine-3-carboxamide (PubChem CID 167224847) has the molecular formula C16H10Cl3F2N3O2 and a molecular weight of 420.63 g/mol. Its IUPAC name is N-[2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]-5,6-difluoropyridine-3-carboxamide.
| Compound Name | N-[2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]-5,6-difluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 167224847 |
| Molecular Formula | C16H10Cl3F2N3O2 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | N-[2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]-5,6-difluoropyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(NC(=O)C2CC2(Cl)Cl)ccc1Cl)c1cnc(F)c(F)c1 |
| InChI | InChI=1S/C16H10Cl3F2N3O2/c17-10-2-1-8(23-15(26)9-5-16(9,18)19)4-12(10)24-14(25)7-3-11(20)13(21)22-6-7/h1-4,6,9H,5H2,(H,23,26)(H,24,25) |
| InChIKey | LHQPDVDORMYRAD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|