C24H18BrCl4N3O2 — CID 122618458
N-(4-amino-2-methylphenyl)-5-[[(1S,3S)-3-(4-bromo-3-chlorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide (PubChem CID 122618458) has the molecular formula C24H18BrCl4N3O2 and a molecular weight of 602.14 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-5-[[(1S,3S)-3-(4-bromo-3-chlorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide.
| Compound Name | N-(4-amino-2-methylphenyl)-5-[[(1S,3S)-3-(4-bromo-3-chlorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 122618458 |
| Molecular Formula | C24H18BrCl4N3O2 |
| Molecular Weight | 602.14 g/mol |
| Exact Mass | 598.93 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-5-[[(1S,3S)-3-(4-bromo-3-chlorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
| SMILES | Cc1cc(N)ccc1NC(=O)c1cc(NC(=O)[C@@H]2[C@@H](c3ccc(Br)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H18BrCl4N3O2/c1-11-8-13(30)3-7-19(11)32-22(33)15-10-14(4-6-17(15)26)31-23(34)21-20(24(21,28)29)12-2-5-16(25)18(27)9-12/h2-10,20-21H,30H2,1H3,(H,31,34)(H,32,33)/t20-,21+/m1/s1 |
| InChIKey | RDHOCYFACLPQSO-RTWAWAEBSA-N |
| XLogP | 7.42 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.14 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|