C17H11Cl6NO — CID 138653681
(3R)-2,2-dichloro-N-(4-chloro-3-methylphenyl)-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 138653681) has the molecular formula C17H11Cl6NO and a molecular weight of 458.00 g/mol. Its IUPAC name is (3R)-2,2-dichloro-N-(4-chloro-3-methylphenyl)-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | (3R)-2,2-dichloro-N-(4-chloro-3-methylphenyl)-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138653681 |
| Molecular Formula | C17H11Cl6NO |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 454.90 |
| IUPAC Name | (3R)-2,2-dichloro-N-(4-chloro-3-methylphenyl)-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C17H11Cl6NO/c1-7-4-9(2-3-10(7)18)24-16(25)14-13(17(14,22)23)8-5-11(19)15(21)12(20)6-8/h2-6,13-14H,1H3,(H,24,25)/t13-,14?/m0/s1 |
| InChIKey | XMFOTNAQHJUYGE-LSLKUGRBSA-N |
| XLogP | 7.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|