C17H12Br2Cl3NO — CID 138653070
2,2-dibromo-N-(4-chloro-3-methylphenyl)-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 138653070) has the molecular formula C17H12Br2Cl3NO and a molecular weight of 512.46 g/mol. Its IUPAC name is 2,2-dibromo-N-(4-chloro-3-methylphenyl)-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dibromo-N-(4-chloro-3-methylphenyl)-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 138653070 |
| Molecular Formula | C17H12Br2Cl3NO |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 508.84 |
| IUPAC Name | 2,2-dibromo-N-(4-chloro-3-methylphenyl)-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Br)Br)ccc1Cl |
| InChI | InChI=1S/C17H12Br2Cl3NO/c1-8-4-12(2-3-13(8)22)23-16(24)15-14(17(15,18)19)9-5-10(20)7-11(21)6-9/h2-7,14-15H,1H3,(H,23,24) |
| InChIKey | NNTYHWAJUIDZFL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|