C27H20Cl6N2O3 — CID 160678086
N-[3-[2-(4-acetamido-2-methylphenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 160678086) has the molecular formula C27H20Cl6N2O3 and a molecular weight of 633.19 g/mol. Its IUPAC name is N-[3-[2-(4-acetamido-2-methylphenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-[2-(4-acetamido-2-methylphenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 160678086 |
| Molecular Formula | C27H20Cl6N2O3 |
| Molecular Weight | 633.19 g/mol |
| Exact Mass | 629.96 |
| IUPAC Name | N-[3-[2-(4-acetamido-2-methylphenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)c2cc(NC(=O)C3C(c4cc(Cl)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C27H20Cl6N2O3/c1-12-7-16(34-13(2)36)4-3-14(12)10-22(37)18-11-17(5-6-19(18)28)35-26(38)24-23(27(24,32)33)15-8-20(29)25(31)21(30)9-15/h3-9,11,23-24H,10H2,1-2H3,(H,34,36)(H,35,38) |
| InChIKey | RNUAXGYXOJCMIC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.19 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|