C30H21Cl6F2NO3 — CID 161046785
trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[2-[3-(3-cyclopropyl-2-oxopropyl)-2,4-difluorophenyl]acetyl]phenyl]-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 161046785) has the molecular formula C30H21Cl6F2NO3 and a molecular weight of 694.22 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[2-[3-(3-cyclopropyl-2-oxopropyl)-2,4-difluorophenyl]acetyl]phenyl]-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[2-[3-(3-cyclopropyl-2-oxopropyl)-2,4-difluorophenyl]acetyl]phenyl]-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 161046785 |
| Molecular Formula | C30H21Cl6F2NO3 |
| Molecular Weight | 694.22 g/mol |
| Exact Mass | 690.96 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[2-[3-(3-cyclopropyl-2-oxopropyl)-2,4-difluorophenyl]acetyl]phenyl]-3-(3,4,5-trichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Cc1c(F)ccc(CC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(Cl)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F)CC1CC1 |
| InChI | InChI=1S/C30H21Cl6F2NO3/c31-20-5-4-16(39-29(42)26-25(30(26,35)36)15-8-21(32)27(34)22(33)9-15)11-18(20)24(41)10-14-3-6-23(37)19(28(14)38)12-17(40)7-13-1-2-13/h3-6,8-9,11,13,25-26H,1-2,7,10,12H2,(H,39,42)/t25-,26+/m0/s1 |
| InChIKey | UBPGJDXKZKCJIV-IZZNHLLZSA-N |
| XLogP | 9.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.22 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|