C23H13BrCl4F2N2O2 — CID 122619382
5-[[(1S,2S)-2-bromo-2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-chloro-N-(2,6-difluorophenyl)benzamide (PubChem CID 122619382) has the molecular formula C23H13BrCl4F2N2O2 and a molecular weight of 609.08 g/mol. Its IUPAC name is 5-[[(1S,2S)-2-bromo-2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-chloro-N-(2,6-difluorophenyl)benzamide.
| Compound Name | 5-[[(1S,2S)-2-bromo-2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-chloro-N-(2,6-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 122619382 |
| Molecular Formula | C23H13BrCl4F2N2O2 |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 605.89 |
| IUPAC Name | 5-[[(1S,2S)-2-bromo-2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-chloro-N-(2,6-difluorophenyl)benzamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc(NC(=O)[C@@H]2C(c3cc(Cl)cc(Cl)c3)[C@]2(Cl)Br)ccc1Cl |
| InChI | InChI=1S/C23H13BrCl4F2N2O2/c24-23(28)18(10-6-11(25)8-12(26)7-10)19(23)22(34)31-13-4-5-15(27)14(9-13)21(33)32-20-16(29)2-1-3-17(20)30/h1-9,18-19H,(H,31,34)(H,32,33)/t18?,19-,23+/m0/s1 |
| InChIKey | YUPHHRBPEBKFCW-HXCXSPQYSA-N |
| XLogP | 7.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|