C23H12Cl5F4N3O2 — CID 140859799
N-(3-amino-2,4,5,6-tetrafluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 140859799) has the molecular formula C23H12Cl5F4N3O2 and a molecular weight of 615.62 g/mol. Its IUPAC name is N-(3-amino-2,4,5,6-tetrafluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-amino-2,4,5,6-tetrafluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 140859799 |
| Molecular Formula | C23H12Cl5F4N3O2 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 612.93 |
| IUPAC Name | N-(3-amino-2,4,5,6-tetrafluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1c(F)c(F)c(F)c(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C23H12Cl5F4N3O2/c24-8-3-7(4-9(25)5-8)13-14(23(13,27)28)22(37)34-10-1-2-12(26)11(6-10)21(36)35-20-17(31)15(29)16(30)19(33)18(20)32/h1-6,13-14H,33H2,(H,34,37)(H,35,36)/t13-,14+/m0/s1 |
| InChIKey | STYUMXSDRYQBBN-UONOGXRCSA-N |
| XLogP | 7.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|