C21H14Cl6F2N2O2 — CID 122615414
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide (PubChem CID 122615414) has the molecular formula C21H14Cl6F2N2O2 and a molecular weight of 577.07 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
|---|---|
| PubChem CID | 122615414 |
| Molecular Formula | C21H14Cl6F2N2O2 |
| Molecular Weight | 577.07 g/mol |
| Exact Mass | 573.92 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
| SMILES | O=C(NC1CC(F)(F)C1)c1cc(NC(=O)[C@@H]2[C@@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H14Cl6F2N2O2/c22-12-2-1-9(5-11(12)18(32)31-10-6-20(28,29)7-10)30-19(33)16-15(21(16,26)27)8-3-13(23)17(25)14(24)4-8/h1-5,10,15-16H,6-7H2,(H,30,33)(H,31,32)/t15-,16+/m1/s1 |
| InChIKey | UPVBHKBDZGVJAK-CVEARBPZSA-N |
| XLogP | 7.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.07 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|