C21H16Cl3F2N3O4 — CID 122615321
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(4-nitrophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide (PubChem CID 122615321) has the molecular formula C21H16Cl3F2N3O4 and a molecular weight of 518.73 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(4-nitrophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(4-nitrophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
|---|---|
| PubChem CID | 122615321 |
| Molecular Formula | C21H16Cl3F2N3O4 |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(4-nitrophenyl)cyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
| SMILES | O=C(NC1CC(F)(F)C1)c1cc(NC(=O)[C@@H]2[C@@H](c3ccc([N+](=O)[O-])cc3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H16Cl3F2N3O4/c22-15-6-3-11(7-14(15)18(30)28-12-8-20(25,26)9-12)27-19(31)17-16(21(17,23)24)10-1-4-13(5-2-10)29(32)33/h1-7,12,16-17H,8-9H2,(H,27,31)(H,28,30)/t16-,17+/m1/s1 |
| InChIKey | KEXVVJZLZQANDX-SJORKVTESA-N |
| XLogP | 5.30 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|