C23H19Cl4FN2O3 — CID 122615409
2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(4-oxocyclohexyl)benzamide (PubChem CID 122615409) has the molecular formula C23H19Cl4FN2O3 and a molecular weight of 532.23 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(4-oxocyclohexyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(4-oxocyclohexyl)benzamide |
|---|---|
| PubChem CID | 122615409 |
| Molecular Formula | C23H19Cl4FN2O3 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-(4-oxocyclohexyl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2cc(NC(=O)C3C(c4ccc(F)c(Cl)c4)C3(Cl)Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C23H19Cl4FN2O3/c24-16-7-4-13(10-15(16)21(32)29-12-2-5-14(31)6-3-12)30-22(33)20-19(23(20,26)27)11-1-8-18(28)17(25)9-11/h1,4,7-10,12,19-20H,2-3,5-6H2,(H,29,32)(H,30,33) |
| InChIKey | YQRNHPLYLGOJKJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|