C24H19Cl6N3O3 — CID 122632813
2-chloro-N-[1-(cyclopropanecarbonyl)azetidin-3-yl]-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122632813) has the molecular formula C24H19Cl6N3O3 and a molecular weight of 610.15 g/mol. Its IUPAC name is 2-chloro-N-[1-(cyclopropanecarbonyl)azetidin-3-yl]-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-N-[1-(cyclopropanecarbonyl)azetidin-3-yl]-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122632813 |
| Molecular Formula | C24H19Cl6N3O3 |
| Molecular Weight | 610.15 g/mol |
| Exact Mass | 606.96 |
| IUPAC Name | 2-chloro-N-[1-(cyclopropanecarbonyl)azetidin-3-yl]-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | O=C(NC1CN(C(=O)C2CC2)C1)c1cc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H19Cl6N3O3/c25-15-4-3-12(7-14(15)21(34)32-13-8-33(9-13)23(36)10-1-2-10)31-22(35)19-18(24(19,29)30)11-5-16(26)20(28)17(27)6-11/h3-7,10,13,18-19H,1-2,8-9H2,(H,31,35)(H,32,34) |
| InChIKey | WKDKEZPQCZUJHQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.15 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|