C25H18Cl5N3O4 — CID 122617921
[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamic acid (PubChem CID 122617921) has the molecular formula C25H18Cl5N3O4 and a molecular weight of 601.70 g/mol. Its IUPAC name is [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamic acid.
| Compound Name | [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 122617921 |
| Molecular Formula | C25H18Cl5N3O4 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 598.97 |
| IUPAC Name | [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)ccc1NC(=O)c1cccc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C25H18Cl5N3O4/c1-11-7-15(32-24(36)37)5-6-18(11)33-22(34)12-3-2-4-14(8-12)31-23(35)20-19(25(20,29)30)13-9-16(26)21(28)17(27)10-13/h2-10,19-20,32H,1H3,(H,31,35)(H,33,34)(H,36,37) |
| InChIKey | RZQHPKFXPAYSCH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|