C29H26Cl5N3O4 — CID 175132659
[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl] N-tert-butylcarbamate (PubChem CID 175132659) has the molecular formula C29H26Cl5N3O4 and a molecular weight of 657.81 g/mol. Its IUPAC name is [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl] N-tert-butylcarbamate.
| Compound Name | [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175132659 |
| Molecular Formula | C29H26Cl5N3O4 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 655.04 |
| IUPAC Name | [4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl] N-tert-butylcarbamate |
| SMILES | Cc1cc(OC(=O)NC(C)(C)C)ccc1NC(=O)c1cccc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C29H26Cl5N3O4/c1-14-10-18(41-27(40)37-28(2,3)4)8-9-21(14)36-25(38)15-6-5-7-17(11-15)35-26(39)23-22(29(23,33)34)16-12-19(30)24(32)20(31)13-16/h5-13,22-23H,1-4H3,(H,35,39)(H,36,38)(H,37,40) |
| InChIKey | SDGZKOPOJZFICV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|