C33H33Cl5N4O5 — CID 134417663
tert-butyl N-[4-[4-[[2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylanilino]-4-oxobutyl]carbamate (PubChem CID 134417663) has the molecular formula C33H33Cl5N4O5 and a molecular weight of 742.91 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylanilino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylanilino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 134417663 |
| Molecular Formula | C33H33Cl5N4O5 |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 740.09 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylanilino]-4-oxobutyl]carbamate |
| SMILES | Cc1cc(NC(=O)CCCNC(=O)OC(C)(C)C)ccc1NC(=O)c1cc(NC(=O)C2C(c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C33H33Cl5N4O5/c1-17-14-19(40-26(43)6-5-13-39-31(46)47-32(2,3)4)9-12-25(17)42-29(44)21-16-20(8-11-22(21)34)41-30(45)28-27(33(28,37)38)18-7-10-23(35)24(36)15-18/h7-12,14-16,27-28H,5-6,13H2,1-4H3,(H,39,46)(H,40,43)(H,41,45)(H,42,44) |
| InChIKey | WIALFJAKYDFFQI-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|