C20H16Cl4N2O2 — CID 122615693
N-cyclopropyl-3-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122615693) has the molecular formula C20H16Cl4N2O2 and a molecular weight of 458.17 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122615693 |
| Molecular Formula | C20H16Cl4N2O2 |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | N-cyclopropyl-3-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(NC(=O)[C@@H]2[C@@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C20H16Cl4N2O2/c21-12-6-11(7-13(22)9-12)16-17(20(16,23)24)19(28)26-15-3-1-2-10(8-15)18(27)25-14-4-5-14/h1-3,6-9,14,16-17H,4-5H2,(H,25,27)(H,26,28)/t16-,17+/m1/s1 |
| InChIKey | JLGLUSUKRKYUTA-SJORKVTESA-N |
| XLogP | 5.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|