C30H26Cl5N3O4 — CID 154957622
(1-methylcyclobutyl) N-[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamate (PubChem CID 154957622) has the molecular formula C30H26Cl5N3O4 and a molecular weight of 669.82 g/mol. Its IUPAC name is (1-methylcyclobutyl) N-[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamate.
| Compound Name | (1-methylcyclobutyl) N-[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamate |
|---|---|
| PubChem CID | 154957622 |
| Molecular Formula | C30H26Cl5N3O4 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 667.04 |
| IUPAC Name | (1-methylcyclobutyl) N-[4-[[3-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-3-methylphenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC2(C)CCC2)ccc1NC(=O)c1cccc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C30H26Cl5N3O4/c1-15-11-19(37-28(41)42-29(2)9-4-10-29)7-8-22(15)38-26(39)16-5-3-6-18(12-16)36-27(40)24-23(30(24,34)35)17-13-20(31)25(33)21(32)14-17/h3,5-8,11-14,23-24H,4,9-10H2,1-2H3,(H,36,40)(H,37,41)(H,38,39) |
| InChIKey | CVBASMJVVKHLNH-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|