C24H17Cl5FN3O2 — CID 134418019
2,2-dichloro-N-[4-chloro-3-[(4-fluoro-2-methylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418019) has the molecular formula C24H17Cl5FN3O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[(4-fluoro-2-methylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[(4-fluoro-2-methylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418019 |
| Molecular Formula | C24H17Cl5FN3O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 572.97 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[(4-fluoro-2-methylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(F)ccc1NNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H17Cl5FN3O2/c1-11-6-15(30)2-5-19(11)32-33-22(34)17-10-16(3-4-18(17)27)31-23(35)21-20(24(21,28)29)12-7-13(25)9-14(26)8-12/h2-10,20-21,32H,1H3,(H,31,35)(H,33,34) |
| InChIKey | UNNXDGAVXIXIKK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|