C25H20Cl5N3O2 — CID 140859744
trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(N,3-dimethylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 140859744) has the molecular formula C25H20Cl5N3O2 and a molecular weight of 571.72 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(N,3-dimethylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(N,3-dimethylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140859744 |
| Molecular Formula | C25H20Cl5N3O2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 569.00 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(N,3-dimethylanilino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(N(C)NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C25H20Cl5N3O2/c1-13-4-3-5-18(8-13)33(2)32-23(34)19-12-17(6-7-20(19)28)31-24(35)22-21(25(22,29)30)14-9-15(26)11-16(27)10-14/h3-12,21-22H,1-2H3,(H,31,35)(H,32,34)/t21-,22+/m0/s1 |
| InChIKey | BDQZBALFDKVYPB-FCHUYYIVSA-N |
| XLogP | 7.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|