C22H18Cl4F3IN2O3 — CID 138650648
2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-iodophenyl)cyclopropanecarbonyl]amino]-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide (PubChem CID 138650648) has the molecular formula C22H18Cl4F3IN2O3 and a molecular weight of 684.11 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-iodophenyl)cyclopropanecarbonyl]amino]-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-iodophenyl)cyclopropanecarbonyl]amino]-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 138650648 |
| Molecular Formula | C22H18Cl4F3IN2O3 |
| Molecular Weight | 684.11 g/mol |
| Exact Mass | 681.91 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-iodophenyl)cyclopropanecarbonyl]amino]-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
| SMILES | O=C(NCCCOCC(F)(F)F)c1cc(NC(=O)C2C(c3cc(Cl)cc(I)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C22H18Cl4F3IN2O3/c23-12-6-11(7-13(30)8-12)17-18(22(17,25)26)20(34)32-14-2-3-16(24)15(9-14)19(33)31-4-1-5-35-10-21(27,28)29/h2-3,6-9,17-18H,1,4-5,10H2,(H,31,33)(H,32,34) |
| InChIKey | DQQGKQSGJIVRNN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.11 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|