C26H22Cl3FN2O2 — CID 122618333
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(4-propan-2-ylphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide (PubChem CID 122618333) has the molecular formula C26H22Cl3FN2O2 and a molecular weight of 519.83 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(4-propan-2-ylphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(4-propan-2-ylphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 122618333 |
| Molecular Formula | C26H22Cl3FN2O2 |
| Molecular Weight | 519.83 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(4-propan-2-ylphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES | CC(C)c1ccc([C@H]2[C@H](C(=O)Nc3ccc(Cl)c(C(=O)Nc4ccc(F)cc4)c3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C26H22Cl3FN2O2/c1-14(2)15-3-5-16(6-4-15)22-23(26(22,28)29)25(34)32-19-11-12-21(27)20(13-19)24(33)31-18-9-7-17(30)8-10-18/h3-14,22-23H,1-2H3,(H,31,33)(H,32,34)/t22-,23+/m0/s1 |
| InChIKey | WRIRJXITYYYCHO-XZOQPEGZSA-N |
| XLogP | 7.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|