C24H16Cl3F3N2O3 — CID 122630341
2-chloro-5-[[2,2-dichloro-3-(3,5-difluoro-4-methoxyphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide (PubChem CID 122630341) has the molecular formula C24H16Cl3F3N2O3 and a molecular weight of 543.76 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-difluoro-4-methoxyphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-difluoro-4-methoxyphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 122630341 |
| Molecular Formula | C24H16Cl3F3N2O3 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-difluoro-4-methoxyphenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES | COc1c(F)cc(C2C(C(=O)Nc3ccc(Cl)c(C(=O)Nc4ccc(F)cc4)c3)C2(Cl)Cl)cc1F |
| InChI | InChI=1S/C24H16Cl3F3N2O3/c1-35-21-17(29)8-11(9-18(21)30)19-20(24(19,26)27)23(34)32-14-6-7-16(25)15(10-14)22(33)31-13-4-2-12(28)3-5-13/h2-10,19-20H,1H3,(H,31,33)(H,32,34) |
| InChIKey | HLBGEZJRVSYOFK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|