C24H17Cl4FN2O4S — CID 122619204
5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfonylbenzamide (PubChem CID 122619204) has the molecular formula C24H17Cl4FN2O4S and a molecular weight of 590.29 g/mol. Its IUPAC name is 5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfonylbenzamide.
| Compound Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122619204 |
| Molecular Formula | C24H17Cl4FN2O4S |
| Molecular Weight | 590.29 g/mol |
| Exact Mass | 587.96 |
| IUPAC Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)cc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Cl4FN2O4S/c1-36(34,35)19-7-6-17(11-18(19)22(32)30-16-4-2-15(29)3-5-16)31-23(33)21-20(24(21,27)28)12-8-13(25)10-14(26)9-12/h2-11,20-21H,1H3,(H,30,32)(H,31,33)/t20-,21+/m0/s1 |
| InChIKey | JEAKCKPQWGCNRZ-LEWJYISDSA-N |
| XLogP | 6.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.29 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|