C23H15Cl4FN2O2 — CID 147531999
2,2-dichloro-3-(3,5-dichlorophenyl)-N-[2-[2-(4-fluorophenyl)acetyl]-4-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 147531999) has the molecular formula C23H15Cl4FN2O2 and a molecular weight of 512.20 g/mol. Its IUPAC name is 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[2-[2-(4-fluorophenyl)acetyl]-4-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[2-[2-(4-fluorophenyl)acetyl]-4-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 147531999 |
| Molecular Formula | C23H15Cl4FN2O2 |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[2-[2-(4-fluorophenyl)acetyl]-4-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Cc1ccc(F)cc1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccn1 |
| InChI | InChI=1S/C23H15Cl4FN2O2/c24-14-8-13(9-15(25)10-14)20-21(23(20,26)27)22(32)30-17-5-6-29-18(11-17)19(31)7-12-1-3-16(28)4-2-12/h1-6,8-11,20-21H,7H2,(H,29,30,32) |
| InChIKey | FNFJGLVESYBZBB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|