C24H15Cl4F2NO2 — CID 146989028
2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(2,4-difluorophenyl)acetyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 146989028) has the molecular formula C24H15Cl4F2NO2 and a molecular weight of 529.20 g/mol. Its IUPAC name is 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(2,4-difluorophenyl)acetyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(2,4-difluorophenyl)acetyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 146989028 |
| Molecular Formula | C24H15Cl4F2NO2 |
| Molecular Weight | 529.20 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(2,4-difluorophenyl)acetyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Cc1ccc(F)cc1F)c1cccc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C24H15Cl4F2NO2/c25-15-6-14(7-16(26)10-15)21-22(24(21,27)28)23(33)31-18-3-1-2-13(8-18)20(32)9-12-4-5-17(29)11-19(12)30/h1-8,10-11,21-22H,9H2,(H,31,33) |
| InChIKey | APVFRCDRTZMTNA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.20 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|