C25H15Cl5N2O2S — CID 152911301
[4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl] thiocyanate (PubChem CID 152911301) has the molecular formula C25H15Cl5N2O2S and a molecular weight of 584.74 g/mol. Its IUPAC name is [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl] thiocyanate.
| Compound Name | [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 152911301 |
| Molecular Formula | C25H15Cl5N2O2S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 581.93 |
| IUPAC Name | [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(CC(=O)c2cc(NC(=O)C3C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H15Cl5N2O2S/c26-15-8-14(9-16(27)10-15)22-23(25(22,29)30)24(34)32-17-3-6-20(28)19(11-17)21(33)7-13-1-4-18(5-2-13)35-12-31/h1-6,8-11,22-23H,7H2,(H,32,34) |
| InChIKey | UHGJOCMUNNCORV-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|