C23H11Cl5F4N2O2 — CID 165144836
N-[3-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-2,6-difluorophenyl]-2,4-difluorobenzamide (PubChem CID 165144836) has the molecular formula C23H11Cl5F4N2O2 and a molecular weight of 600.61 g/mol. Its IUPAC name is N-[3-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-2,6-difluorophenyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-2,6-difluorophenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 165144836 |
| Molecular Formula | C23H11Cl5F4N2O2 |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 597.92 |
| IUPAC Name | N-[3-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-2,6-difluorophenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1c(F)ccc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)c1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H11Cl5F4N2O2/c24-11-5-8(6-12(25)18(11)26)16-17(23(16,27)28)22(36)33-15-4-3-13(30)20(19(15)32)34-21(35)10-2-1-9(29)7-14(10)31/h1-7,16-17H,(H,33,36)(H,34,35)/t16-,17+/m0/s1 |
| InChIKey | DFGWJGHTMSIDNL-DLBZAZTESA-N |
| XLogP | 7.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|