C25H18Cl3F4N3O2 — CID 140860138
N-(3-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide (PubChem CID 140860138) has the molecular formula C25H18Cl3F4N3O2 and a molecular weight of 574.79 g/mol. Its IUPAC name is N-(3-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 140860138 |
| Molecular Formula | C25H18Cl3F4N3O2 |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | N-(3-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
| SMILES | Cc1c(N)cccc1NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3ccc(F)c(C(F)(F)F)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C25H18Cl3F4N3O2/c1-11-18(33)3-2-4-19(11)35-22(36)14-10-13(6-7-16(14)26)34-23(37)21-20(24(21,27)28)12-5-8-17(29)15(9-12)25(30,31)32/h2-10,20-21H,33H2,1H3,(H,34,37)(H,35,36)/t20-,21+/m0/s1 |
| InChIKey | DRWPVWTUDGWLAP-LEWJYISDSA-N |
| XLogP | 7.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|