C12H10Cl2O2 — CID 599126
5-(3,4-dichlorophenyl)cyclohexane-1,3-dione (PubChem CID 599126) has the molecular formula C12H10Cl2O2 and a molecular weight of 257.12 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(3,4-dichlorophenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 599126 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-(3,4-dichlorophenyl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)CC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H10Cl2O2/c13-11-2-1-7(5-12(11)14)8-3-9(15)6-10(16)4-8/h1-2,5,8H,3-4,6H2 |
| InChIKey | RNSOWNAHAULUPX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|