C10H5Cl5O — CID 174088210
(1S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carbaldehyde (PubChem CID 174088210) has the molecular formula C10H5Cl5O and a molecular weight of 318.41 g/mol. Its IUPAC name is (1S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carbaldehyde.
| Compound Name | (1S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 174088210 |
| Molecular Formula | C10H5Cl5O |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 315.88 |
| IUPAC Name | (1S)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropane-1-carbaldehyde |
| SMILES | O=C[C@@H]1C(c2cc(Cl)c(Cl)c(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H5Cl5O/c11-6-1-4(2-7(12)9(6)13)8-5(3-16)10(8,14)15/h1-3,5,8H/t5-,8?/m1/s1 |
| InChIKey | NSTLGYZPPUVKIT-RUQIKYNFSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|