C9H5Cl4F — CID 138703094
1,2-dichloro-5-(2,2-dichlorocyclopropyl)-3-fluorobenzene (PubChem CID 138703094) has the molecular formula C9H5Cl4F and a molecular weight of 273.95 g/mol. Its IUPAC name is 1,2-dichloro-5-(2,2-dichlorocyclopropyl)-3-fluorobenzene.
| Compound Name | 1,2-dichloro-5-(2,2-dichlorocyclopropyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 138703094 |
| Molecular Formula | C9H5Cl4F |
| Molecular Weight | 273.95 g/mol |
| Exact Mass | 271.91 |
| IUPAC Name | 1,2-dichloro-5-(2,2-dichlorocyclopropyl)-3-fluorobenzene |
| SMILES | Fc1cc(C2CC2(Cl)Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl4F/c10-6-1-4(2-7(14)8(6)11)5-3-9(5,12)13/h1-2,5H,3H2 |
| InChIKey | BEQWOCLFGGEHQA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|