C9H8Cl2S — CID 124636072
3-[(1R)-2,2-dichlorocyclopropyl]benzenethiol (PubChem CID 124636072) has the molecular formula C9H8Cl2S and a molecular weight of 219.14 g/mol. Its IUPAC name is 3-[(1R)-2,2-dichlorocyclopropyl]benzenethiol.
| Compound Name | 3-[(1R)-2,2-dichlorocyclopropyl]benzenethiol |
|---|---|
| PubChem CID | 124636072 |
| Molecular Formula | C9H8Cl2S |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 3-[(1R)-2,2-dichlorocyclopropyl]benzenethiol |
| SMILES | Sc1cccc([C@H]2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C9H8Cl2S/c10-9(11)5-8(9)6-2-1-3-7(12)4-6/h1-4,8,12H,5H2/t8-/m1/s1 |
| InChIKey | RNVFOBQNTIXCLU-MRVPVSSYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|