About ethane;3-fluorobenzenethiol
ethane;3-fluorobenzenethiol (PubChem CID 145424033) has the molecular formula C8H11FS
and a molecular weight of 158.24 g/mol. Its IUPAC name is ethane;3-fluorobenzenethiol.
Molecular Properties
| Compound Name | ethane;3-fluorobenzenethiol |
| PubChem CID | 145424033 |
| Molecular Formula | C8H11FS |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | ethane;3-fluorobenzenethiol |
| SMILES | CC.Fc1cccc(S)c1 |
| InChI | InChI=1S/C6H5FS.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H;1-2H3 |
| InChIKey | BAQWOPLGONKLIS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-fluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluorobenzenethiol?
The IUPAC name of ethane;3-fluorobenzenethiol (CID 145424033) is ethane;3-fluorobenzenethiol.
What is the SMILES notation for ethane;3-fluorobenzenethiol?
The canonical SMILES for ethane;3-fluorobenzenethiol is CC.Fc1cccc(S)c1.
What is the InChIKey of ethane;3-fluorobenzenethiol?
The InChIKey is BAQWOPLGONKLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FS.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H;1-2H3.
What are the key properties of ethane;3-fluorobenzenethiol?
ethane;3-fluorobenzenethiol has a molecular weight of 158.24 g/mol, XLogP of 3.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluorobenzenethiol is sourced from PubChem (CID 145424033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).