C11H15NS — CID 116988736
3-piperidin-3-ylbenzenethiol (PubChem CID 116988736) has the molecular formula C11H15NS and a molecular weight of 193.32 g/mol. Its IUPAC name is 3-piperidin-3-ylbenzenethiol.
| Compound Name | 3-piperidin-3-ylbenzenethiol |
|---|---|
| PubChem CID | 116988736 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-piperidin-3-ylbenzenethiol |
| SMILES | Sc1cccc(C2CCCNC2)c1 |
| InChI | InChI=1S/C11H15NS/c13-11-5-1-3-9(7-11)10-4-2-6-12-8-10/h1,3,5,7,10,12-13H,2,4,6,8H2 |
| InChIKey | YUXFXULZFMDBQE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|