C11H16NOP — CID 144633040
(3-piperidin-3-ylphenoxy)phosphane (PubChem CID 144633040) has the molecular formula C11H16NOP and a molecular weight of 209.23 g/mol. Its IUPAC name is (3-piperidin-3-ylphenoxy)phosphane.
| Compound Name | (3-piperidin-3-ylphenoxy)phosphane |
|---|---|
| PubChem CID | 144633040 |
| Molecular Formula | C11H16NOP |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (3-piperidin-3-ylphenoxy)phosphane |
| SMILES | POc1cccc(C2CCCNC2)c1 |
| InChI | InChI=1S/C11H16NOP/c14-13-11-5-1-3-9(7-11)10-4-2-6-12-8-10/h1,3,5,7,10,12H,2,4,6,8,14H2 |
| InChIKey | PFKLUHUVUZBDTA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|