About 3-cyclobutylbenzenethiol
3-cyclobutylbenzenethiol (PubChem CID 139494537) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 3-cyclobutylbenzenethiol.
Molecular Properties
| Compound Name | 3-cyclobutylbenzenethiol |
| PubChem CID | 139494537 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-cyclobutylbenzenethiol |
| SMILES | Sc1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C10H12S/c11-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8,11H,1,3-4H2 |
| InChIKey | WNCABWQILDEAOA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutylbenzenethiol?
The IUPAC name of 3-cyclobutylbenzenethiol (CID 139494537) is 3-cyclobutylbenzenethiol.
What is the SMILES notation for 3-cyclobutylbenzenethiol?
The canonical SMILES for 3-cyclobutylbenzenethiol is Sc1cccc(C2CCC2)c1.
What is the InChIKey of 3-cyclobutylbenzenethiol?
The InChIKey is WNCABWQILDEAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S/c11-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8,11H,1,3-4H2.
What are the key properties of 3-cyclobutylbenzenethiol?
3-cyclobutylbenzenethiol has a molecular weight of 164.27 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutylbenzenethiol is sourced from PubChem (CID 139494537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).