About 3-chlorobenzenethiol;ethane
3-chlorobenzenethiol;ethane (PubChem CID 142302277) has the molecular formula C8H11ClS
and a molecular weight of 174.70 g/mol. Its IUPAC name is 3-chlorobenzenethiol;ethane.
Molecular Properties
| Compound Name | 3-chlorobenzenethiol;ethane |
| PubChem CID | 142302277 |
| Molecular Formula | C8H11ClS |
| Molecular Weight | 174.70 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 3-chlorobenzenethiol;ethane |
| SMILES | CC.Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H5ClS.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H;1-2H3 |
| InChIKey | VECKYFKHAJSZFK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzenethiol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzenethiol;ethane?
The IUPAC name of 3-chlorobenzenethiol;ethane (CID 142302277) is 3-chlorobenzenethiol;ethane.
What is the SMILES notation for 3-chlorobenzenethiol;ethane?
The canonical SMILES for 3-chlorobenzenethiol;ethane is CC.Sc1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzenethiol;ethane?
The InChIKey is VECKYFKHAJSZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H;1-2H3.
What are the key properties of 3-chlorobenzenethiol;ethane?
3-chlorobenzenethiol;ethane has a molecular weight of 174.70 g/mol, XLogP of 3.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzenethiol;ethane is sourced from PubChem (CID 142302277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).