C14H16ClF — CID 134441423
2-chloro-4-(2,2-dimethyl-3-prop-1-en-2-ylcyclopropyl)-1-fluorobenzene (PubChem CID 134441423) has the molecular formula C14H16ClF and a molecular weight of 238.73 g/mol. Its IUPAC name is 2-chloro-4-(2,2-dimethyl-3-prop-1-en-2-ylcyclopropyl)-1-fluorobenzene.
| Compound Name | 2-chloro-4-(2,2-dimethyl-3-prop-1-en-2-ylcyclopropyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 134441423 |
| Molecular Formula | C14H16ClF |
| Molecular Weight | 238.73 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-chloro-4-(2,2-dimethyl-3-prop-1-en-2-ylcyclopropyl)-1-fluorobenzene |
| SMILES | C=C(C)C1C(c2ccc(F)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C14H16ClF/c1-8(2)12-13(14(12,3)4)9-5-6-11(16)10(15)7-9/h5-7,12-13H,1H2,2-4H3 |
| InChIKey | QXOZHVORBKABPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|